C36H57N9O3 — CID 161182988
1-[2-(3-aminopropoxy)-5-propan-2-ylphenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine (PubChem CID 161182988) has the molecular formula C36H57N9O3 and a molecular weight of 663.91 g/mol. Its IUPAC name is 1-[2-(3-aminopropoxy)-5-propan-2-ylphenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine.
| Compound Name | 1-[2-(3-aminopropoxy)-5-propan-2-ylphenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 161182988 |
| Molecular Formula | C36H57N9O3 |
| Molecular Weight | 663.91 g/mol |
| Exact Mass | 663.46 |
| IUPAC Name | 1-[2-(3-aminopropoxy)-5-propan-2-ylphenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine |
| SMILES | CC(C)(C)c1ncc(-c2ccc(CNCCCN=C(N)N)cc2)c(=O)[nH]1.CC(C)c1ccc(OCCCN)c(NC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C19H28N6O.C17H29N3O2/c1-19(2,3)17-24-12-15(16(26)25-17)14-7-5-13(6-8-14)11-22-9-4-10-23-18(20)21;1-12(2)13-7-8-15(22-10-6-9-18)14(11-13)19-16(21)20-17(3,4)5/h5-8,12,22H,4,9-11H2,1-3H3,(H4,20,21,23)(H,24,25,26);7-8,11-12H,6,9-10,18H2,1-5H3,(H2,19,20,21) |
| InChIKey | USSHZOTZPYFUNH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 198.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.91 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|