C15H20N6O — CID 66581808
2-[3-[[4-(6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine (PubChem CID 66581808) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is 2-[3-[[4-(6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-(6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 66581808 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-[3-[[4-(6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine |
| SMILES | NC(N)=NCCCNCc1ccc(-c2cnc[nH]c2=O)cc1 |
| InChI | InChI=1S/C15H20N6O/c16-15(17)20-7-1-6-18-8-11-2-4-12(5-3-11)13-9-19-10-21-14(13)22/h2-5,9-10,18H,1,6-8H2,(H4,16,17,20)(H,19,21,22) |
| InChIKey | MPIJDFLIPIIKFA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 122.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|