C18H26Cl2N4 — CID 90665177
2-[4-[(4-phenylphenyl)methylamino]butyl]guanidine;dihydrochloride (PubChem CID 90665177) has the molecular formula C18H26Cl2N4 and a molecular weight of 369.34 g/mol. Its IUPAC name is 2-[4-[(4-phenylphenyl)methylamino]butyl]guanidine;dihydrochloride.
| Compound Name | 2-[4-[(4-phenylphenyl)methylamino]butyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 90665177 |
| Molecular Formula | C18H26Cl2N4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-[4-[(4-phenylphenyl)methylamino]butyl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=NCCCCNCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H24N4.2ClH/c19-18(20)22-13-5-4-12-21-14-15-8-10-17(11-9-15)16-6-2-1-3-7-16;;/h1-3,6-11,21H,4-5,12-14H2,(H4,19,20,22);2*1H |
| InChIKey | YZBUPNASGUAQAU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|