C17H23N5O — CID 118857796
2-[3-[[4-(6-methyl-4-oxo-1H-pyridin-3-yl)phenyl]methylamino]propyl]guanidine (PubChem CID 118857796) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 2-[3-[[4-(6-methyl-4-oxo-1H-pyridin-3-yl)phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-(6-methyl-4-oxo-1H-pyridin-3-yl)phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 118857796 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 2-[3-[[4-(6-methyl-4-oxo-1H-pyridin-3-yl)phenyl]methylamino]propyl]guanidine |
| SMILES | Cc1cc(=O)c(-c2ccc(CNCCCN=C(N)N)cc2)c[nH]1 |
| InChI | InChI=1S/C17H23N5O/c1-12-9-16(23)15(11-22-12)14-5-3-13(4-6-14)10-20-7-2-8-21-17(18)19/h3-6,9,11,20H,2,7-8,10H2,1H3,(H,22,23)(H4,18,19,21) |
| InChIKey | XHYVWCABFIQWOM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|