C21H28FN7O — CID 90210330
2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-3-fluorophenyl]methylamino]propyl]guanidine (PubChem CID 90210330) has the molecular formula C21H28FN7O and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-3-fluorophenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-3-fluorophenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 90210330 |
| Molecular Formula | C21H28FN7O |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-3-fluorophenyl]methylamino]propyl]guanidine |
| SMILES | CC(C)(C)c1cc2cn(-c3ccc(CNCCCN=C(N)N)cc3F)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C21H28FN7O/c1-21(2,3)17-10-14-12-29(20(30)28-18(14)27-17)16-6-5-13(9-15(16)22)11-25-7-4-8-26-19(23)24/h5-6,9-10,12,25H,4,7-8,11H2,1-3H3,(H4,23,24,26)(H,27,28,30) |
| InChIKey | LJPRPZURESJYOK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|