C36H50F3N9O — CID 159754337
2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine;N-[1-(4-tert-butylphenyl)-2,2,2-trifluoroethyl]azetidin-3-amine (PubChem CID 159754337) has the molecular formula C36H50F3N9O and a molecular weight of 681.85 g/mol. Its IUPAC name is 2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine;N-[1-(4-tert-butylphenyl)-2,2,2-trifluoroethyl]azetidin-3-amine.
| Compound Name | 2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine;N-[1-(4-tert-butylphenyl)-2,2,2-trifluoroethyl]azetidin-3-amine |
|---|---|
| PubChem CID | 159754337 |
| Molecular Formula | C36H50F3N9O |
| Molecular Weight | 681.85 g/mol |
| Exact Mass | 681.41 |
| IUPAC Name | 2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine;N-[1-(4-tert-butylphenyl)-2,2,2-trifluoroethyl]azetidin-3-amine |
| SMILES | CC(C)(C)c1cc2cn(-c3ccc(CNCCCN=C(N)N)cc3)c(=O)nc2[nH]1.CC(C)(C)c1ccc(C(NC2CNC2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H29N7O.C15H21F3N2/c1-21(2,3)17-11-15-13-28(20(29)27-18(15)26-17)16-7-5-14(6-8-16)12-24-9-4-10-25-19(22)23;1-14(2,3)11-6-4-10(5-7-11)13(15(16,17)18)20-12-8-19-9-12/h5-8,11,13,24H,4,9-10,12H2,1-3H3,(H4,22,23,25)(H,26,27,29);4-7,12-13,19-20H,8-9H2,1-3H3 |
| InChIKey | NEBDLGPRHZOITL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 151.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.85 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|