C37H54ClFN8O — CID 160590655
5-(3-tert-butyl-5-chloro-4-fluorophenyl)-2-methylpentan-2-amine;2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine (PubChem CID 160590655) has the molecular formula C37H54ClFN8O and a molecular weight of 681.35 g/mol. Its IUPAC name is 5-(3-tert-butyl-5-chloro-4-fluorophenyl)-2-methylpentan-2-amine;2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine.
| Compound Name | 5-(3-tert-butyl-5-chloro-4-fluorophenyl)-2-methylpentan-2-amine;2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 160590655 |
| Molecular Formula | C37H54ClFN8O |
| Molecular Weight | 681.35 g/mol |
| Exact Mass | 680.41 |
| IUPAC Name | 5-(3-tert-butyl-5-chloro-4-fluorophenyl)-2-methylpentan-2-amine;2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine |
| SMILES | CC(C)(C)c1cc2cn(-c3ccc(CNCCCN=C(N)N)cc3)c(=O)nc2[nH]1.CC(C)(N)CCCc1cc(Cl)c(F)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H29N7O.C16H25ClFN/c1-21(2,3)17-11-15-13-28(20(29)27-18(15)26-17)16-7-5-14(6-8-16)12-24-9-4-10-25-19(22)23;1-15(2,3)12-9-11(10-13(17)14(12)18)7-6-8-16(4,5)19/h5-8,11,13,24H,4,9-10,12H2,1-3H3,(H4,22,23,25)(H,26,27,29);9-10H,6-8,19H2,1-5H3 |
| InChIKey | RCYSGWXEGNLSCD-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 153.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.35 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|