C35H49N9O2 — CID 159310924
N-(azetidin-3-yl)-4-tert-butylbenzamide;2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine (PubChem CID 159310924) has the molecular formula C35H49N9O2 and a molecular weight of 627.84 g/mol. Its IUPAC name is N-(azetidin-3-yl)-4-tert-butylbenzamide;2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine.
| Compound Name | N-(azetidin-3-yl)-4-tert-butylbenzamide;2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 159310924 |
| Molecular Formula | C35H49N9O2 |
| Molecular Weight | 627.84 g/mol |
| Exact Mass | 627.40 |
| IUPAC Name | N-(azetidin-3-yl)-4-tert-butylbenzamide;2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine |
| SMILES | CC(C)(C)c1cc2cn(-c3ccc(CNCCCN=C(N)N)cc3)c(=O)nc2[nH]1.CC(C)(C)c1ccc(C(=O)NC2CNC2)cc1 |
| InChI | InChI=1S/C21H29N7O.C14H20N2O/c1-21(2,3)17-11-15-13-28(20(29)27-18(15)26-17)16-7-5-14(6-8-16)12-24-9-4-10-25-19(22)23;1-14(2,3)11-6-4-10(5-7-11)13(17)16-12-8-15-9-12/h5-8,11,13,24H,4,9-10,12H2,1-3H3,(H4,22,23,25)(H,26,27,29);4-7,12,15H,8-9H2,1-3H3,(H,16,17) |
| InChIKey | LCNLOTLSVKBRLV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 168.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.84 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|