C36H52N8O3 — CID 158347472
2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine;2-[(3-tert-butylphenoxy)methyl]morpholine (PubChem CID 158347472) has the molecular formula C36H52N8O3 and a molecular weight of 644.87 g/mol. Its IUPAC name is 2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine;2-[(3-tert-butylphenoxy)methyl]morpholine.
| Compound Name | 2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine;2-[(3-tert-butylphenoxy)methyl]morpholine |
|---|---|
| PubChem CID | 158347472 |
| Molecular Formula | C36H52N8O3 |
| Molecular Weight | 644.87 g/mol |
| Exact Mass | 644.42 |
| IUPAC Name | 2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine;2-[(3-tert-butylphenoxy)methyl]morpholine |
| SMILES | CC(C)(C)c1cc2cn(-c3ccc(CNCCCN=C(N)N)cc3)c(=O)nc2[nH]1.CC(C)(C)c1cccc(OCC2CNCCO2)c1 |
| InChI | InChI=1S/C21H29N7O.C15H23NO2/c1-21(2,3)17-11-15-13-28(20(29)27-18(15)26-17)16-7-5-14(6-8-16)12-24-9-4-10-25-19(22)23;1-15(2,3)12-5-4-6-13(9-12)18-11-14-10-16-7-8-17-14/h5-8,11,13,24H,4,9-10,12H2,1-3H3,(H4,22,23,25)(H,26,27,29);4-6,9,14,16H,7-8,10-11H2,1-3H3 |
| InChIKey | GRXGTPTUVAXPFN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 157.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.87 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|