C35H50Cl2N8O — CID 158417814
4-(3-tert-butyl-2,4-dichlorophenyl)butan-1-amine;2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine (PubChem CID 158417814) has the molecular formula C35H50Cl2N8O and a molecular weight of 669.75 g/mol. Its IUPAC name is 4-(3-tert-butyl-2,4-dichlorophenyl)butan-1-amine;2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine.
| Compound Name | 4-(3-tert-butyl-2,4-dichlorophenyl)butan-1-amine;2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 158417814 |
| Molecular Formula | C35H50Cl2N8O |
| Molecular Weight | 669.75 g/mol |
| Exact Mass | 668.35 |
| IUPAC Name | 4-(3-tert-butyl-2,4-dichlorophenyl)butan-1-amine;2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine |
| SMILES | CC(C)(C)c1c(Cl)ccc(CCCCN)c1Cl.CC(C)(C)c1cc2cn(-c3ccc(CNCCCN=C(N)N)cc3)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C21H29N7O.C14H21Cl2N/c1-21(2,3)17-11-15-13-28(20(29)27-18(15)26-17)16-7-5-14(6-8-16)12-24-9-4-10-25-19(22)23;1-14(2,3)12-11(15)8-7-10(13(12)16)6-4-5-9-17/h5-8,11,13,24H,4,9-10,12H2,1-3H3,(H4,22,23,25)(H,26,27,29);7-8H,4-6,9,17H2,1-3H3 |
| InChIKey | HACPXCDQRCMRDC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 153.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.75 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|