C28H32ClF3N8O2S — CID 71475520
2-[3-[[4-[6-[5-(4-aminobutyl)-2-chloro-3-(trifluoromethylsulfinyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 71475520) has the molecular formula C28H32ClF3N8O2S and a molecular weight of 637.13 g/mol. Its IUPAC name is 2-[3-[[4-[6-[5-(4-aminobutyl)-2-chloro-3-(trifluoromethylsulfinyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-[5-(4-aminobutyl)-2-chloro-3-(trifluoromethylsulfinyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 71475520 |
| Molecular Formula | C28H32ClF3N8O2S |
| Molecular Weight | 637.13 g/mol |
| Exact Mass | 636.20 |
| IUPAC Name | 2-[3-[[4-[6-[5-(4-aminobutyl)-2-chloro-3-(trifluoromethylsulfinyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | NCCCCc1cc(-c2cc3cn(-c4ccc(CNCCCN=C(N)N)cc4)c(=O)nc3[nH]2)c(Cl)c(S(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C28H32ClF3N8O2S/c29-24-21(12-18(4-1-2-9-33)13-23(24)43(42)28(30,31)32)22-14-19-16-40(27(41)39-25(19)38-22)20-7-5-17(6-8-20)15-36-10-3-11-37-26(34)35/h5-8,12-14,16,36H,1-4,9-11,15,33H2,(H4,34,35,37)(H,38,39,41) |
| InChIKey | XSAPGWYHPQFDLU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 170.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.13 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|