C32H41ClFN7O2 — CID 145398142
N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]-2-methoxyethanimidamide;ethene (PubChem CID 145398142) has the molecular formula C32H41ClFN7O2 and a molecular weight of 610.18 g/mol. Its IUPAC name is N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]-2-methoxyethanimidamide;ethene.
| Compound Name | N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]-2-methoxyethanimidamide;ethene |
|---|---|
| PubChem CID | 145398142 |
| Molecular Formula | C32H41ClFN7O2 |
| Molecular Weight | 610.18 g/mol |
| Exact Mass | 609.30 |
| IUPAC Name | N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]-2-methoxyethanimidamide;ethene |
| SMILES | C=C.COC/C(N)=N\CCCNCc1ccc(-n2cc3cc(-c4cc(CCCC(C)N)cc(Cl)c4F)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C30H37ClFN7O2.C2H4/c1-19(33)5-3-6-21-13-24(28(32)25(31)14-21)26-15-22-17-39(30(40)38-29(22)37-26)23-9-7-20(8-10-23)16-35-11-4-12-36-27(34)18-41-2;1-2/h7-10,13-15,17,19,35H,3-6,11-12,16,18,33H2,1-2H3,(H2,34,36)(H,37,38,40);1-2H2 |
| InChIKey | QCKDLXWRCSDPOX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.18 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|