C33H41ClF2N8O — CID 138735160
N'-[3-[[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]-2-(3-fluoropyrrolidin-1-yl)ethanimidamide (PubChem CID 138735160) has the molecular formula C33H41ClF2N8O and a molecular weight of 639.20 g/mol. Its IUPAC name is N'-[3-[[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]-2-(3-fluoropyrrolidin-1-yl)ethanimidamide.
| Compound Name | N'-[3-[[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]-2-(3-fluoropyrrolidin-1-yl)ethanimidamide |
|---|---|
| PubChem CID | 138735160 |
| Molecular Formula | C33H41ClF2N8O |
| Molecular Weight | 639.20 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | N'-[3-[[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]-2-(3-fluoropyrrolidin-1-yl)ethanimidamide |
| SMILES | C[C@H](N)CCCc1cc(Cl)c(F)c(-c2cc3cn(-c4ccc(CNCCC/N=C(\N)CN5CCC(F)C5)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C33H41ClF2N8O/c1-21(37)4-2-5-23-14-27(31(36)28(34)15-23)29-16-24-18-44(33(45)42-32(24)41-29)26-8-6-22(7-9-26)17-39-11-3-12-40-30(38)20-43-13-10-25(35)19-43/h6-9,14-16,18,21,25,39H,2-5,10-13,17,19-20,37H2,1H3,(H2,38,40)(H,41,42,45)/t21-,25?/m0/s1 |
| InChIKey | KPVOGXOUIGWVHU-BWDMCYIDSA-N |
| XLogP | 4.72 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.20 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|