C33H41ClFN7O — CID 145398042
N'-[3-[[4-[6-[5-(4-aminohex-5-enyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;cyclopropane (PubChem CID 145398042) has the molecular formula C33H41ClFN7O and a molecular weight of 606.19 g/mol. Its IUPAC name is N'-[3-[[4-[6-[5-(4-aminohex-5-enyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;cyclopropane.
| Compound Name | N'-[3-[[4-[6-[5-(4-aminohex-5-enyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;cyclopropane |
|---|---|
| PubChem CID | 145398042 |
| Molecular Formula | C33H41ClFN7O |
| Molecular Weight | 606.19 g/mol |
| Exact Mass | 605.30 |
| IUPAC Name | N'-[3-[[4-[6-[5-(4-aminohex-5-enyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;cyclopropane |
| SMILES | C1CC1.C=CC(N)CCCc1cc(Cl)c(F)c(-c2cc3cn(-c4ccc(CNCCC/N=C(\C)N)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C30H35ClFN7O.C3H6/c1-3-23(34)7-4-6-21-14-25(28(32)26(31)15-21)27-16-22-18-39(30(40)38-29(22)37-27)24-10-8-20(9-11-24)17-35-12-5-13-36-19(2)33;1-2-3-1/h3,8-11,14-16,18,23,35H,1,4-7,12-13,17,34H2,2H3,(H2,33,36)(H,37,38,40);1-3H2 |
| InChIKey | LPXTXRXOUJBTQB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.19 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|