C34H43F4N7O2 — CID 145397990
N'-[3-[[4-[6-[5-(4-amino-5-methoxypentyl)-2-fluoro-3-(trifluoromethyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;cyclopropane (PubChem CID 145397990) has the molecular formula C34H43F4N7O2 and a molecular weight of 657.76 g/mol. Its IUPAC name is N'-[3-[[4-[6-[5-(4-amino-5-methoxypentyl)-2-fluoro-3-(trifluoromethyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;cyclopropane.
| Compound Name | N'-[3-[[4-[6-[5-(4-amino-5-methoxypentyl)-2-fluoro-3-(trifluoromethyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;cyclopropane |
|---|---|
| PubChem CID | 145397990 |
| Molecular Formula | C34H43F4N7O2 |
| Molecular Weight | 657.76 g/mol |
| Exact Mass | 657.34 |
| IUPAC Name | N'-[3-[[4-[6-[5-(4-amino-5-methoxypentyl)-2-fluoro-3-(trifluoromethyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;cyclopropane |
| SMILES | C1CC1.COCC(N)CCCc1cc(-c2cc3cn(-c4ccc(CNCCC/N=C(\C)N)cc4)c(=O)nc3[nH]2)c(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H37F4N7O2.C3H6/c1-19(36)39-12-4-11-38-16-20-7-9-24(10-8-20)42-17-22-15-27(40-29(22)41-30(42)43)25-13-21(5-3-6-23(37)18-44-2)14-26(28(25)32)31(33,34)35;1-2-3-1/h7-10,13-15,17,23,38H,3-6,11-12,16,18,37H2,1-2H3,(H2,36,39)(H,40,41,43);1-3H2 |
| InChIKey | INKRMHSOXGGSLP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.76 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|