C31H39ClFN7O2 — CID 145398274
N'-[3-[[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]-2-methoxyethyl]amino]propyl]ethanimidamide (PubChem CID 145398274) has the molecular formula C31H39ClFN7O2 and a molecular weight of 596.15 g/mol. Its IUPAC name is N'-[3-[[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]-2-methoxyethyl]amino]propyl]ethanimidamide.
| Compound Name | N'-[3-[[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]-2-methoxyethyl]amino]propyl]ethanimidamide |
|---|---|
| PubChem CID | 145398274 |
| Molecular Formula | C31H39ClFN7O2 |
| Molecular Weight | 596.15 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | N'-[3-[[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]-2-methoxyethyl]amino]propyl]ethanimidamide |
| SMILES | COCC(NCCC/N=C(\C)N)c1ccc(-n2cc3cc(-c4cc(CCCC(C)N)cc(Cl)c4F)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C31H39ClFN7O2/c1-19(34)6-4-7-21-14-25(29(33)26(32)15-21)27-16-23-17-40(31(41)39-30(23)38-27)24-10-8-22(9-11-24)28(18-42-3)37-13-5-12-36-20(2)35/h8-11,14-17,19,28,37H,4-7,12-13,18,34H2,1-3H3,(H2,35,36)(H,38,39,41) |
| InChIKey | GPVCAYGWUFIQTQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.15 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|