C33H46ClFN8O — CID 145398425
2-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]butylamino]propyl]guanidine;ethane (PubChem CID 145398425) has the molecular formula C33H46ClFN8O and a molecular weight of 625.24 g/mol. Its IUPAC name is 2-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]butylamino]propyl]guanidine;ethane.
| Compound Name | 2-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]butylamino]propyl]guanidine;ethane |
|---|---|
| PubChem CID | 145398425 |
| Molecular Formula | C33H46ClFN8O |
| Molecular Weight | 625.24 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | 2-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]butylamino]propyl]guanidine;ethane |
| SMILES | CC.CCCC(NCCCN=C(N)N)c1ccc(-n2cc3cc(-c4cc(CCCC(C)N)cc(Cl)c4F)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C31H40ClFN8O.C2H6/c1-3-6-26(37-13-5-14-38-30(35)36)21-9-11-23(12-10-21)41-18-22-17-27(39-29(22)40-31(41)42)24-15-20(8-4-7-19(2)34)16-25(32)28(24)33;1-2/h9-12,15-19,26,37H,3-8,13-14,34H2,1-2H3,(H4,35,36,38)(H,39,40,42);1-2H3 |
| InChIKey | PPIHVQOHXTYEPI-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 153.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.24 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|