C32H40ClF2N7O — CID 145398168
N'-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-fluorophenyl]butylamino]propyl]ethanimidamide (PubChem CID 145398168) has the molecular formula C32H40ClF2N7O and a molecular weight of 612.17 g/mol. Its IUPAC name is N'-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-fluorophenyl]butylamino]propyl]ethanimidamide.
| Compound Name | N'-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-fluorophenyl]butylamino]propyl]ethanimidamide |
|---|---|
| PubChem CID | 145398168 |
| Molecular Formula | C32H40ClF2N7O |
| Molecular Weight | 612.17 g/mol |
| Exact Mass | 611.30 |
| IUPAC Name | N'-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-fluorophenyl]butylamino]propyl]ethanimidamide |
| SMILES | CCCC(NCCC/N=C(\C)N)c1ccc(-n2cc3cc(-c4cc(CCCC(C)N)cc(Cl)c4F)[nH]c3nc2=O)cc1F |
| InChI | InChI=1S/C32H40ClF2N7O/c1-4-7-28(39-13-6-12-38-20(3)37)24-11-10-23(17-27(24)34)42-18-22-16-29(40-31(22)41-32(42)43)25-14-21(9-5-8-19(2)36)15-26(33)30(25)35/h10-11,14-19,28,39H,4-9,12-13,36H2,1-3H3,(H2,37,38)(H,40,41,43) |
| InChIKey | ZCZPAYLXKTTWOK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.17 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|