C34H45ClFN7OS — CID 145398093
N'-[3-[1-[4-[6-[5-(4-aminobutyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-methylsulfanylphenyl]butylamino]propyl]ethanimidamide;ethene (PubChem CID 145398093) has the molecular formula C34H45ClFN7OS and a molecular weight of 654.30 g/mol. Its IUPAC name is N'-[3-[1-[4-[6-[5-(4-aminobutyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-methylsulfanylphenyl]butylamino]propyl]ethanimidamide;ethene.
| Compound Name | N'-[3-[1-[4-[6-[5-(4-aminobutyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-methylsulfanylphenyl]butylamino]propyl]ethanimidamide;ethene |
|---|---|
| PubChem CID | 145398093 |
| Molecular Formula | C34H45ClFN7OS |
| Molecular Weight | 654.30 g/mol |
| Exact Mass | 653.31 |
| IUPAC Name | N'-[3-[1-[4-[6-[5-(4-aminobutyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-methylsulfanylphenyl]butylamino]propyl]ethanimidamide;ethene |
| SMILES | C=C.CCCC(NCCC/N=C(\C)N)c1ccc(-n2cc3cc(-c4cc(CCCCN)cc(Cl)c4F)[nH]c3nc2=O)cc1SC |
| InChI | InChI=1S/C32H41ClFN7OS.C2H4/c1-4-8-27(38-14-7-13-37-20(2)36)24-11-10-23(18-29(24)43-3)41-19-22-17-28(39-31(22)40-32(41)42)25-15-21(9-5-6-12-35)16-26(33)30(25)34;1-2/h10-11,15-19,27,38H,4-9,12-14,35H2,1-3H3,(H2,36,37)(H,39,40,42);1-2H2 |
| InChIKey | PROVSSPNJLRVGW-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.30 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|