C33H42ClFN8O2 — CID 145398112
3-amino-6-[3-[3-[4-[1-[3-(1-aminoethylideneamino)propylamino]butyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-5-chloro-4-fluorophenyl]hexanamide (PubChem CID 145398112) has the molecular formula C33H42ClFN8O2 and a molecular weight of 637.20 g/mol. Its IUPAC name is 3-amino-6-[3-[3-[4-[1-[3-(1-aminoethylideneamino)propylamino]butyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-5-chloro-4-fluorophenyl]hexanamide.
| Compound Name | 3-amino-6-[3-[3-[4-[1-[3-(1-aminoethylideneamino)propylamino]butyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-5-chloro-4-fluorophenyl]hexanamide |
|---|---|
| PubChem CID | 145398112 |
| Molecular Formula | C33H42ClFN8O2 |
| Molecular Weight | 637.20 g/mol |
| Exact Mass | 636.31 |
| IUPAC Name | 3-amino-6-[3-[3-[4-[1-[3-(1-aminoethylideneamino)propylamino]butyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-5-chloro-4-fluorophenyl]hexanamide |
| SMILES | CCCC(NCCC/N=C(\C)N)c1ccc(-n2cc3cc(-c4cc(CCCC(N)CC(N)=O)cc(Cl)c4F)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C33H42ClFN8O2/c1-3-6-28(40-14-5-13-39-20(2)36)22-9-11-25(12-10-22)43-19-23-17-29(41-32(23)42-33(43)45)26-15-21(16-27(34)31(26)35)7-4-8-24(37)18-30(38)44/h9-12,15-17,19,24,28,40H,3-8,13-14,18,37H2,1-2H3,(H2,36,39)(H2,38,44)(H,41,42,45) |
| InChIKey | YNSCSYPCPNCCBQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 170.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.20 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|