C32H39ClFN7O2 — CID 166718489
N'-[3-[[(1R)-1-[4-[6-[5-(4-amino-4-cyclopropylbutyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]-2-hydroxyethyl]amino]propyl]ethanimidamide (PubChem CID 166718489) has the molecular formula C32H39ClFN7O2 and a molecular weight of 608.16 g/mol. Its IUPAC name is N'-[3-[[(1R)-1-[4-[6-[5-(4-amino-4-cyclopropylbutyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]-2-hydroxyethyl]amino]propyl]ethanimidamide.
| Compound Name | N'-[3-[[(1R)-1-[4-[6-[5-(4-amino-4-cyclopropylbutyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]-2-hydroxyethyl]amino]propyl]ethanimidamide |
|---|---|
| PubChem CID | 166718489 |
| Molecular Formula | C32H39ClFN7O2 |
| Molecular Weight | 608.16 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | N'-[3-[[(1R)-1-[4-[6-[5-(4-amino-4-cyclopropylbutyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]-2-hydroxyethyl]amino]propyl]ethanimidamide |
| SMILES | C/C(N)=N\CCCN[C@@H](CO)c1ccc(-n2cc3cc(-c4cc(CCCC(N)C5CC5)cc(Cl)c4F)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C32H39ClFN7O2/c1-19(35)37-12-3-13-38-29(18-42)22-8-10-24(11-9-22)41-17-23-16-28(39-31(23)40-32(41)43)25-14-20(15-26(33)30(25)34)4-2-5-27(36)21-6-7-21/h8-11,14-17,21,27,29,38,42H,2-7,12-13,18,36H2,1H3,(H2,35,37)(H,39,40,43)/t27?,29-/m0/s1 |
| InChIKey | ZSYZCLNHUVINLZ-ACEFPKFPSA-N |
| XLogP | 4.62 |
| TPSA | 147.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.16 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|