C30H35ClFN7O2 — CID 145154345
2-[3-[[4-[6-[5-(4-amino-4-cyclopropylbutyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]propyl]guanidine (PubChem CID 145154345) has the molecular formula C30H35ClFN7O2 and a molecular weight of 580.11 g/mol. Its IUPAC name is 2-[3-[[4-[6-[5-(4-amino-4-cyclopropylbutyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-[5-(4-amino-4-cyclopropylbutyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]propyl]guanidine |
|---|---|
| PubChem CID | 145154345 |
| Molecular Formula | C30H35ClFN7O2 |
| Molecular Weight | 580.11 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | 2-[3-[[4-[6-[5-(4-amino-4-cyclopropylbutyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]propyl]guanidine |
| SMILES | NC(N)=NCCCOCc1ccc(-n2cc3cc(-c4cc(CCCC(N)C5CC5)cc(Cl)c4F)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C30H35ClFN7O2/c31-24-14-19(3-1-4-25(33)20-7-8-20)13-23(27(24)32)26-15-21-16-39(30(40)38-28(21)37-26)22-9-5-18(6-10-22)17-41-12-2-11-36-29(34)35/h5-6,9-10,13-16,20,25H,1-4,7-8,11-12,17,33H2,(H4,34,35,36)(H,37,38,40) |
| InChIKey | LPZVBNQJNDKFDW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 150.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.11 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|