C32H39ClFN7O2 — CID 122432845
2-[3-[(2S,4R)-4-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]oxan-2-yl]propyl]guanidine (PubChem CID 122432845) has the molecular formula C32H39ClFN7O2 and a molecular weight of 608.16 g/mol. Its IUPAC name is 2-[3-[(2S,4R)-4-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]oxan-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(2S,4R)-4-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]oxan-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 122432845 |
| Molecular Formula | C32H39ClFN7O2 |
| Molecular Weight | 608.16 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | 2-[3-[(2S,4R)-4-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]oxan-2-yl]propyl]guanidine |
| SMILES | C[C@H](N)CCCc1cc(Cl)c(F)c(-c2cc3cn(-c4ccc([C@@H]5CCO[C@@H](CCCN=C(N)N)C5)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C32H39ClFN7O2/c1-19(35)4-2-5-20-14-26(29(34)27(33)15-20)28-17-23-18-41(32(42)40-30(23)39-28)24-9-7-21(8-10-24)22-11-13-43-25(16-22)6-3-12-38-31(36)37/h7-10,14-15,17-19,22,25H,2-6,11-13,16,35H2,1H3,(H4,36,37,38)(H,39,40,42)/t19-,22+,25-/m0/s1 |
| InChIKey | NKDQHLDUANOTPI-SWHJIRTISA-N |
| XLogP | 5.16 |
| TPSA | 150.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.16 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|