C29H35ClFN7O2S — CID 145398381
2-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-methylsulfanylphenyl]methoxy]propyl]guanidine (PubChem CID 145398381) has the molecular formula C29H35ClFN7O2S and a molecular weight of 600.16 g/mol. Its IUPAC name is 2-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-methylsulfanylphenyl]methoxy]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-methylsulfanylphenyl]methoxy]propyl]guanidine |
|---|---|
| PubChem CID | 145398381 |
| Molecular Formula | C29H35ClFN7O2S |
| Molecular Weight | 600.16 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | 2-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-methylsulfanylphenyl]methoxy]propyl]guanidine |
| SMILES | CSc1cc(-n2cc3cc(-c4cc(CCCC(C)N)cc(Cl)c4F)[nH]c3nc2=O)ccc1COCCCN=C(N)N |
| InChI | InChI=1S/C29H35ClFN7O2S/c1-17(32)5-3-6-18-11-22(26(31)23(30)12-18)24-13-20-15-38(29(39)37-27(20)36-24)21-8-7-19(25(14-21)41-2)16-40-10-4-9-35-28(33)34/h7-8,11-15,17H,3-6,9-10,16,32H2,1-2H3,(H4,33,34,35)(H,36,37,39) |
| InChIKey | OOBCLOKCJWDABD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 150.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.16 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|