C34H47FN8O3 — CID 145398441
2-[(3S)-3-[[4-[6-[5-[(4S)-4-aminopentyl]-2-fluoro-3-methylphenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-(2-methoxyethoxymethyl)phenyl]methylamino]butyl]guanidine (PubChem CID 145398441) has the molecular formula C34H47FN8O3 and a molecular weight of 634.80 g/mol. Its IUPAC name is 2-[(3S)-3-[[4-[6-[5-[(4S)-4-aminopentyl]-2-fluoro-3-methylphenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-(2-methoxyethoxymethyl)phenyl]methylamino]butyl]guanidine.
| Compound Name | 2-[(3S)-3-[[4-[6-[5-[(4S)-4-aminopentyl]-2-fluoro-3-methylphenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-(2-methoxyethoxymethyl)phenyl]methylamino]butyl]guanidine |
|---|---|
| PubChem CID | 145398441 |
| Molecular Formula | C34H47FN8O3 |
| Molecular Weight | 634.80 g/mol |
| Exact Mass | 634.38 |
| IUPAC Name | 2-[(3S)-3-[[4-[6-[5-[(4S)-4-aminopentyl]-2-fluoro-3-methylphenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-(2-methoxyethoxymethyl)phenyl]methylamino]butyl]guanidine |
| SMILES | COCCOCc1cc(-n2cc3cc(-c4cc(CCC[C@H](C)N)cc(C)c4F)[nH]c3nc2=O)ccc1CN[C@@H](C)CCN=C(N)N |
| InChI | InChI=1S/C34H47FN8O3/c1-21-14-24(7-5-6-22(2)36)15-29(31(21)35)30-17-26-19-43(34(44)42-32(26)41-30)28-9-8-25(27(16-28)20-46-13-12-45-4)18-40-23(3)10-11-39-33(37)38/h8-9,14-17,19,22-23,40H,5-7,10-13,18,20,36H2,1-4H3,(H4,37,38,39)(H,41,42,44)/t22-,23-/m0/s1 |
| InChIKey | GFNLJJAMZSMEPS-GOTSBHOMSA-N |
| XLogP | 3.80 |
| TPSA | 171.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|