C27H32ClFN8O — CID 122428143
2-[(3R)-3-amino-3-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]propyl]guanidine (PubChem CID 122428143) has the molecular formula C27H32ClFN8O and a molecular weight of 539.06 g/mol. Its IUPAC name is 2-[(3R)-3-amino-3-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]propyl]guanidine.
| Compound Name | 2-[(3R)-3-amino-3-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]propyl]guanidine |
|---|---|
| PubChem CID | 122428143 |
| Molecular Formula | C27H32ClFN8O |
| Molecular Weight | 539.06 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 2-[(3R)-3-amino-3-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]propyl]guanidine |
| SMILES | C[C@H](N)CCCc1cc(Cl)c(F)c(-c2cc3cn(-c4ccc([C@H](N)CCN=C(N)N)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C27H32ClFN8O/c1-15(30)3-2-4-16-11-20(24(29)21(28)12-16)23-13-18-14-37(27(38)36-25(18)35-23)19-7-5-17(6-8-19)22(31)9-10-34-26(32)33/h5-8,11-15,22H,2-4,9-10,30-31H2,1H3,(H4,32,33,34)(H,35,36,38)/t15-,22+/m0/s1 |
| InChIKey | AOXHOJCTXHLKNK-OYHNWAKOSA-N |
| XLogP | 3.51 |
| TPSA | 167.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.06 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|