C30H36ClFN8O2 — CID 122540971
2-[2-[4-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]morpholin-2-yl]ethyl]guanidine (PubChem CID 122540971) has the molecular formula C30H36ClFN8O2 and a molecular weight of 595.12 g/mol. Its IUPAC name is 2-[2-[4-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]morpholin-2-yl]ethyl]guanidine.
| Compound Name | 2-[2-[4-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]morpholin-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 122540971 |
| Molecular Formula | C30H36ClFN8O2 |
| Molecular Weight | 595.12 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | 2-[2-[4-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]morpholin-2-yl]ethyl]guanidine |
| SMILES | C[C@H](N)CCCc1cc(Cl)c(F)c(-c2cc3cn(-c4ccc(N5CCOC(CCN=C(N)N)C5)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C30H36ClFN8O2/c1-18(33)3-2-4-19-13-24(27(32)25(31)14-19)26-15-20-16-40(30(41)38-28(20)37-26)22-7-5-21(6-8-22)39-11-12-42-23(17-39)9-10-36-29(34)35/h5-8,13-16,18,23H,2-4,9-12,17,33H2,1H3,(H4,34,35,36)(H,37,38,41)/t18-,23?/m0/s1 |
| InChIKey | AZNQNSYAQLOJPS-XNUZUHMRSA-N |
| XLogP | 3.71 |
| TPSA | 153.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.12 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|