C29H34ClFN8O — CID 122428266
2-[2-[3-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]azetidin-3-yl]ethyl]guanidine (PubChem CID 122428266) has the molecular formula C29H34ClFN8O and a molecular weight of 565.10 g/mol. Its IUPAC name is 2-[2-[3-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]azetidin-3-yl]ethyl]guanidine.
| Compound Name | 2-[2-[3-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]azetidin-3-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 122428266 |
| Molecular Formula | C29H34ClFN8O |
| Molecular Weight | 565.10 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | 2-[2-[3-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]azetidin-3-yl]ethyl]guanidine |
| SMILES | C[C@H](N)CCCc1cc(Cl)c(F)c(-c2cc3cn(-c4ccc(C5(CCN=C(N)N)CNC5)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C29H34ClFN8O/c1-17(32)3-2-4-18-11-22(25(31)23(30)12-18)24-13-19-14-39(28(40)38-26(19)37-24)21-7-5-20(6-8-21)29(15-35-16-29)9-10-36-27(33)34/h5-8,11-14,17,35H,2-4,9-10,15-16,32H2,1H3,(H4,33,34,36)(H,37,38,40)/t17-/m0/s1 |
| InChIKey | ONSHKBJTMLODBE-KRWDZBQOSA-N |
| XLogP | 3.35 |
| TPSA | 153.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.10 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|