C30H38ClFN8O — CID 122428349
2-[(3S)-1-[[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]pentan-3-yl]guanidine (PubChem CID 122428349) has the molecular formula C30H38ClFN8O and a molecular weight of 581.14 g/mol. Its IUPAC name is 2-[(3S)-1-[[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]pentan-3-yl]guanidine.
| Compound Name | 2-[(3S)-1-[[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]pentan-3-yl]guanidine |
|---|---|
| PubChem CID | 122428349 |
| Molecular Formula | C30H38ClFN8O |
| Molecular Weight | 581.14 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | 2-[(3S)-1-[[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]pentan-3-yl]guanidine |
| SMILES | CC[C@@H](CCNCc1ccc(-n2cc3cc(-c4cc(CCC[C@H](C)N)cc(Cl)c4F)[nH]c3nc2=O)cc1)N=C(N)N |
| InChI | InChI=1S/C30H38ClFN8O/c1-3-22(37-29(34)35)11-12-36-16-19-7-9-23(10-8-19)40-17-21-15-26(38-28(21)39-30(40)41)24-13-20(6-4-5-18(2)33)14-25(31)27(24)32/h7-10,13-15,17-18,22,36H,3-6,11-12,16,33H2,1-2H3,(H4,34,35,37)(H,38,39,41)/t18-,22-/m0/s1 |
| InChIKey | BJCGBWRJZFVINA-AVRDEDQJSA-N |
| XLogP | 4.37 |
| TPSA | 153.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.14 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|