C33H42ClFN8OS — CID 145398320
N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]-2-thiomorpholin-4-ylethanimidamide (PubChem CID 145398320) has the molecular formula C33H42ClFN8OS and a molecular weight of 653.27 g/mol. Its IUPAC name is N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]-2-thiomorpholin-4-ylethanimidamide.
| Compound Name | N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]-2-thiomorpholin-4-ylethanimidamide |
|---|---|
| PubChem CID | 145398320 |
| Molecular Formula | C33H42ClFN8OS |
| Molecular Weight | 653.27 g/mol |
| Exact Mass | 652.29 |
| IUPAC Name | N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]-2-thiomorpholin-4-ylethanimidamide |
| SMILES | CC(N)CCCc1cc(Cl)c(F)c(-c2cc3cn(-c4ccc(CNCCC/N=C(\N)CN5CCSCC5)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C33H42ClFN8OS/c1-22(36)4-2-5-24-16-27(31(35)28(34)17-24)29-18-25-20-43(33(44)41-32(25)40-29)26-8-6-23(7-9-26)19-38-10-3-11-39-30(37)21-42-12-14-45-15-13-42/h6-9,16-18,20,22,38H,2-5,10-15,19,21,36H2,1H3,(H2,37,39)(H,40,41,44) |
| InChIKey | ITFURRGXQMXJJM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.27 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|