C29H36ClFN8O2 — CID 122456525
2-[3-[[4-[6-[5-[(4R)-4-amino-5-methoxypentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 122456525) has the molecular formula C29H36ClFN8O2 and a molecular weight of 583.11 g/mol. Its IUPAC name is 2-[3-[[4-[6-[5-[(4R)-4-amino-5-methoxypentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-[5-[(4R)-4-amino-5-methoxypentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 122456525 |
| Molecular Formula | C29H36ClFN8O2 |
| Molecular Weight | 583.11 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | 2-[3-[[4-[6-[5-[(4R)-4-amino-5-methoxypentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | COC[C@H](N)CCCc1cc(Cl)c(F)c(-c2cc3cn(-c4ccc(CNCCCN=C(N)N)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C29H36ClFN8O2/c1-41-17-21(32)5-2-4-19-12-23(26(31)24(30)13-19)25-14-20-16-39(29(40)38-27(20)37-25)22-8-6-18(7-9-22)15-35-10-3-11-36-28(33)34/h6-9,12-14,16,21,35H,2-5,10-11,15,17,32H2,1H3,(H4,33,34,36)(H,37,38,40)/t21-/m1/s1 |
| InChIKey | BKNQQXKHDAYZDI-OAQYLSRUSA-N |
| XLogP | 3.22 |
| TPSA | 162.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.11 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|