C31H40FN7O — CID 122450444
2-[3-[[4-[6-[3-ethyl-2-fluoro-5-(4-methylpentyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 122450444) has the molecular formula C31H40FN7O and a molecular weight of 545.71 g/mol. Its IUPAC name is 2-[3-[[4-[6-[3-ethyl-2-fluoro-5-(4-methylpentyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-[3-ethyl-2-fluoro-5-(4-methylpentyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 122450444 |
| Molecular Formula | C31H40FN7O |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | 2-[3-[[4-[6-[3-ethyl-2-fluoro-5-(4-methylpentyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | CCc1cc(CCCC(C)C)cc(-c2cc3cn(-c4ccc(CNCCCN=C(N)N)cc4)c(=O)nc3[nH]2)c1F |
| InChI | InChI=1S/C31H40FN7O/c1-4-23-15-22(8-5-7-20(2)3)16-26(28(23)32)27-17-24-19-39(31(40)38-29(24)37-27)25-11-9-21(10-12-25)18-35-13-6-14-36-30(33)34/h9-12,15-17,19-20,35H,4-8,13-14,18H2,1-3H3,(H4,33,34,36)(H,37,38,40) |
| InChIKey | RWINFMAFHUNODJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|