C28H34ClFN6O — CID 134389737
3-[4-[[3-(aminomethylamino)propylamino]methyl]phenyl]-6-[3-chloro-2-fluoro-5-(3-methylbutyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one (PubChem CID 134389737) has the molecular formula C28H34ClFN6O and a molecular weight of 525.07 g/mol. Its IUPAC name is 3-[4-[[3-(aminomethylamino)propylamino]methyl]phenyl]-6-[3-chloro-2-fluoro-5-(3-methylbutyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one.
| Compound Name | 3-[4-[[3-(aminomethylamino)propylamino]methyl]phenyl]-6-[3-chloro-2-fluoro-5-(3-methylbutyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 134389737 |
| Molecular Formula | C28H34ClFN6O |
| Molecular Weight | 525.07 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 3-[4-[[3-(aminomethylamino)propylamino]methyl]phenyl]-6-[3-chloro-2-fluoro-5-(3-methylbutyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one |
| SMILES | CC(C)CCc1cc(Cl)c(F)c(-c2cc3cn(-c4ccc(CNCCCNCN)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C28H34ClFN6O/c1-18(2)4-5-20-12-23(26(30)24(29)13-20)25-14-21-16-36(28(37)35-27(21)34-25)22-8-6-19(7-9-22)15-32-10-3-11-33-17-31/h6-9,12-14,16,18,32-33H,3-5,10-11,15,17,31H2,1-2H3,(H,34,35,37) |
| InChIKey | SLMZXIGXLBSHQO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.07 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|