C31H40ClF2N7O2 — CID 145398030
N'-[3-[[4-[6-[5-(4-amino-5-fluoropentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;methoxymethane (PubChem CID 145398030) has the molecular formula C31H40ClF2N7O2 and a molecular weight of 616.16 g/mol. Its IUPAC name is N'-[3-[[4-[6-[5-(4-amino-5-fluoropentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;methoxymethane.
| Compound Name | N'-[3-[[4-[6-[5-(4-amino-5-fluoropentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;methoxymethane |
|---|---|
| PubChem CID | 145398030 |
| Molecular Formula | C31H40ClF2N7O2 |
| Molecular Weight | 616.16 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | N'-[3-[[4-[6-[5-(4-amino-5-fluoropentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;methoxymethane |
| SMILES | C/C(N)=N\CCCNCc1ccc(-n2cc3cc(-c4cc(CCCC(N)CF)cc(Cl)c4F)[nH]c3nc2=O)cc1.COC |
| InChI | InChI=1S/C29H34ClF2N7O.C2H6O/c1-18(33)36-11-3-10-35-16-19-6-8-23(9-7-19)39-17-21-14-26(37-28(21)38-29(39)40)24-12-20(13-25(30)27(24)32)4-2-5-22(34)15-31;1-3-2/h6-9,12-14,17,22,35H,2-5,10-11,15-16,34H2,1H3,(H2,33,36)(H,37,38,40);1-2H3 |
| InChIKey | DSYJOLJMIHQSNE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.16 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|