C30H37ClFN7O2 — CID 122450448
2-[3-[[4-[6-[3-chloro-2-fluoro-5-[(4R)-5-methoxy-4-methylpentyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 122450448) has the molecular formula C30H37ClFN7O2 and a molecular weight of 582.12 g/mol. Its IUPAC name is 2-[3-[[4-[6-[3-chloro-2-fluoro-5-[(4R)-5-methoxy-4-methylpentyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-[3-chloro-2-fluoro-5-[(4R)-5-methoxy-4-methylpentyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 122450448 |
| Molecular Formula | C30H37ClFN7O2 |
| Molecular Weight | 582.12 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | 2-[3-[[4-[6-[3-chloro-2-fluoro-5-[(4R)-5-methoxy-4-methylpentyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | COC[C@H](C)CCCc1cc(Cl)c(F)c(-c2cc3cn(-c4ccc(CNCCCN=C(N)N)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C30H37ClFN7O2/c1-19(18-41-2)5-3-6-21-13-24(27(32)25(31)14-21)26-15-22-17-39(30(40)38-28(22)37-26)23-9-7-20(8-10-23)16-35-11-4-12-36-29(33)34/h7-10,13-15,17,19,35H,3-6,11-12,16,18H2,1-2H3,(H4,33,34,36)(H,37,38,40)/t19-/m1/s1 |
| InChIKey | HJXHSXFYPCPYCK-LJQANCHMSA-N |
| XLogP | 4.53 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.12 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|