C30H37ClFN7O — CID 157261728
2-[(3S)-3-[[4-[6-[3-chloro-2-fluoro-5-(4-methylpentyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]butyl]guanidine (PubChem CID 157261728) has the molecular formula C30H37ClFN7O and a molecular weight of 566.13 g/mol. Its IUPAC name is 2-[(3S)-3-[[4-[6-[3-chloro-2-fluoro-5-(4-methylpentyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]butyl]guanidine.
| Compound Name | 2-[(3S)-3-[[4-[6-[3-chloro-2-fluoro-5-(4-methylpentyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]butyl]guanidine |
|---|---|
| PubChem CID | 157261728 |
| Molecular Formula | C30H37ClFN7O |
| Molecular Weight | 566.13 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | 2-[(3S)-3-[[4-[6-[3-chloro-2-fluoro-5-(4-methylpentyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]butyl]guanidine |
| SMILES | CC(C)CCCc1cc(Cl)c(F)c(-c2cc3cn(-c4ccc(CN[C@@H](C)CCN=C(N)N)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C30H37ClFN7O/c1-18(2)5-4-6-21-13-24(27(32)25(31)14-21)26-15-22-17-39(30(40)38-28(22)37-26)23-9-7-20(8-10-23)16-36-19(3)11-12-35-29(33)34/h7-10,13-15,17-19,36H,4-6,11-12,16H2,1-3H3,(H4,33,34,35)(H,37,38,40)/t19-/m0/s1 |
| InChIKey | AXNRODNPPIFGNW-IBGZPJMESA-N |
| XLogP | 5.29 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.13 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|