C31H38ClFN8O — CID 122428608
2-[(3S,5R)-5-[[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]hex-1-en-3-yl]guanidine (PubChem CID 122428608) has the molecular formula C31H38ClFN8O and a molecular weight of 593.15 g/mol. Its IUPAC name is 2-[(3S,5R)-5-[[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]hex-1-en-3-yl]guanidine.
| Compound Name | 2-[(3S,5R)-5-[[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]hex-1-en-3-yl]guanidine |
|---|---|
| PubChem CID | 122428608 |
| Molecular Formula | C31H38ClFN8O |
| Molecular Weight | 593.15 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | 2-[(3S,5R)-5-[[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]hex-1-en-3-yl]guanidine |
| SMILES | C=C[C@H](C[C@@H](C)NCc1ccc(-n2cc3cc(-c4cc(CCC[C@H](C)N)cc(Cl)c4F)[nH]c3nc2=O)cc1)N=C(N)N |
| InChI | InChI=1S/C31H38ClFN8O/c1-4-23(38-30(35)36)12-19(3)37-16-20-8-10-24(11-9-20)41-17-22-15-27(39-29(22)40-31(41)42)25-13-21(7-5-6-18(2)34)14-26(32)28(25)33/h4,8-11,13-15,17-19,23,37H,1,5-7,12,16,34H2,2-3H3,(H4,35,36,38)(H,39,40,42)/t18-,19+,23+/m0/s1 |
| InChIKey | RRJDEBAHNYARDI-YCRNBWNJSA-N |
| XLogP | 4.54 |
| TPSA | 153.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.15 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|