C32H39ClFN7OS — CID 145398104
N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]pent-4-enyl]-2-methylsulfanylethanimidamide (PubChem CID 145398104) has the molecular formula C32H39ClFN7OS and a molecular weight of 624.23 g/mol. Its IUPAC name is N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]pent-4-enyl]-2-methylsulfanylethanimidamide.
| Compound Name | N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]pent-4-enyl]-2-methylsulfanylethanimidamide |
|---|---|
| PubChem CID | 145398104 |
| Molecular Formula | C32H39ClFN7OS |
| Molecular Weight | 624.23 g/mol |
| Exact Mass | 623.26 |
| IUPAC Name | N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]pent-4-enyl]-2-methylsulfanylethanimidamide |
| SMILES | C=CC(CC/N=C(/N)CSC)NCc1ccc(-n2cc3cc(-c4cc(CCCC(C)N)cc(Cl)c4F)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C32H39ClFN7OS/c1-4-24(12-13-37-29(36)19-43-3)38-17-21-8-10-25(11-9-21)41-18-23-16-28(39-31(23)40-32(41)42)26-14-22(7-5-6-20(2)35)15-27(33)30(26)34/h4,8-11,14-16,18,20,24,38H,1,5-7,12-13,17,19,35H2,2-3H3,(H2,36,37)(H,39,40,42) |
| InChIKey | BDXLDBAEHPBGTN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.23 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|