C31H42ClFN8O — CID 145398205
N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;N-methylmethanamine (PubChem CID 145398205) has the molecular formula C31H42ClFN8O and a molecular weight of 597.18 g/mol. Its IUPAC name is N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;N-methylmethanamine.
| Compound Name | N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;N-methylmethanamine |
|---|---|
| PubChem CID | 145398205 |
| Molecular Formula | C31H42ClFN8O |
| Molecular Weight | 597.18 g/mol |
| Exact Mass | 596.32 |
| IUPAC Name | N'-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]ethanimidamide;N-methylmethanamine |
| SMILES | C/C(N)=N\CCCNCc1ccc(-n2cc3cc(-c4cc(CCCC(C)N)cc(Cl)c4F)[nH]c3nc2=O)cc1.CNC |
| InChI | InChI=1S/C29H35ClFN7O.C2H7N/c1-18(32)5-3-6-21-13-24(27(31)25(30)14-21)26-15-22-17-38(29(39)37-28(22)36-26)23-9-7-20(8-10-23)16-34-11-4-12-35-19(2)33;1-3-2/h7-10,13-15,17-18,34H,3-6,11-12,16,32H2,1-2H3,(H2,33,35)(H,36,37,39);3H,1-2H3 |
| InChIKey | GDJMQVFVTXGPJT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 139.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.18 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|