C31H37ClFN7O2 — CID 122541100
2-[2-[(2R,4R)-2-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]oxan-4-yl]ethyl]guanidine (PubChem CID 122541100) has the molecular formula C31H37ClFN7O2 and a molecular weight of 594.14 g/mol. Its IUPAC name is 2-[2-[(2R,4R)-2-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]oxan-4-yl]ethyl]guanidine.
| Compound Name | 2-[2-[(2R,4R)-2-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]oxan-4-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 122541100 |
| Molecular Formula | C31H37ClFN7O2 |
| Molecular Weight | 594.14 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | 2-[2-[(2R,4R)-2-[4-[6-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]oxan-4-yl]ethyl]guanidine |
| SMILES | C[C@H](N)CCCc1cc(Cl)c(F)c(-c2cc3cn(-c4ccc([C@H]5C[C@H](CCN=C(N)N)CCO5)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C31H37ClFN7O2/c1-18(34)3-2-4-20-13-24(28(33)25(32)14-20)26-16-22-17-40(31(41)39-29(22)38-26)23-7-5-21(6-8-23)27-15-19(10-12-42-27)9-11-37-30(35)36/h5-8,13-14,16-19,27H,2-4,9-12,15,34H2,1H3,(H4,35,36,37)(H,38,39,41)/t18-,19+,27+/m0/s1 |
| InChIKey | IMERNXUNPGKLIC-DSNGTPCMSA-N |
| XLogP | 4.97 |
| TPSA | 150.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.14 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|