C33H40ClFN6O3 — CID 147240340
2-[2-[(2R)-2-[4-[6-[3-chloro-2-fluoro-5-(4-methylpentyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]-6-(hydroxymethyl)oxan-4-yl]ethyl]guanidine (PubChem CID 147240340) has the molecular formula C33H40ClFN6O3 and a molecular weight of 623.17 g/mol. Its IUPAC name is 2-[2-[(2R)-2-[4-[6-[3-chloro-2-fluoro-5-(4-methylpentyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]-6-(hydroxymethyl)oxan-4-yl]ethyl]guanidine.
| Compound Name | 2-[2-[(2R)-2-[4-[6-[3-chloro-2-fluoro-5-(4-methylpentyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]-6-(hydroxymethyl)oxan-4-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 147240340 |
| Molecular Formula | C33H40ClFN6O3 |
| Molecular Weight | 623.17 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | 2-[2-[(2R)-2-[4-[6-[3-chloro-2-fluoro-5-(4-methylpentyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]-6-(hydroxymethyl)oxan-4-yl]ethyl]guanidine |
| SMILES | CC(C)CCCc1cc(Cl)c(F)c(-c2cc3cn(-c4ccc([C@H]5CC(CCN=C(N)N)CC(CO)O5)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C33H40ClFN6O3/c1-19(2)4-3-5-20-13-26(30(35)27(34)14-20)28-16-23-17-41(33(43)40-31(23)39-28)24-8-6-22(7-9-24)29-15-21(10-11-38-32(36)37)12-25(18-42)44-29/h6-9,13-14,16-17,19,21,25,29,42H,3-5,10-12,15,18H2,1-2H3,(H4,36,37,38)(H,39,40,43)/t21?,25?,29-/m1/s1 |
| InChIKey | CKQJLGPELMQRGN-CXBZOWBPSA-N |
| XLogP | 5.64 |
| TPSA | 144.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.17 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|