C31H40ClF2N7O3 — CID 145398250
N'-[3-[1-[4-[6-[5-(4-amino-5-hydroxypentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-fluorophenyl]ethylamino]propyl]ethanimidamide;methanol (PubChem CID 145398250) has the molecular formula C31H40ClF2N7O3 and a molecular weight of 632.16 g/mol. Its IUPAC name is N'-[3-[1-[4-[6-[5-(4-amino-5-hydroxypentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-fluorophenyl]ethylamino]propyl]ethanimidamide;methanol.
| Compound Name | N'-[3-[1-[4-[6-[5-(4-amino-5-hydroxypentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-fluorophenyl]ethylamino]propyl]ethanimidamide;methanol |
|---|---|
| PubChem CID | 145398250 |
| Molecular Formula | C31H40ClF2N7O3 |
| Molecular Weight | 632.16 g/mol |
| Exact Mass | 631.28 |
| IUPAC Name | N'-[3-[1-[4-[6-[5-(4-amino-5-hydroxypentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-fluorophenyl]ethylamino]propyl]ethanimidamide;methanol |
| SMILES | C/C(N)=N\CCCNC(C)c1ccc(-n2cc3cc(-c4cc(CCCC(N)CO)cc(Cl)c4F)[nH]c3nc2=O)cc1F.CO |
| InChI | InChI=1S/C30H36ClF2N7O2.CH4O/c1-17(36-9-4-10-37-18(2)34)23-8-7-22(14-26(23)32)40-15-20-13-27(38-29(20)39-30(40)42)24-11-19(12-25(31)28(24)33)5-3-6-21(35)16-41;1-2/h7-8,11-15,17,21,36,41H,3-6,9-10,16,35H2,1-2H3,(H2,34,37)(H,38,39,42);2H,1H3 |
| InChIKey | GWCZAWNFGCJIIF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 167.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.16 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|