C33H44ClFN8O2 — CID 145398326
2-amino-N'-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]butylamino]propyl]-3-hydroxypropanimidamide (PubChem CID 145398326) has the molecular formula C33H44ClFN8O2 and a molecular weight of 639.22 g/mol. Its IUPAC name is 2-amino-N'-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]butylamino]propyl]-3-hydroxypropanimidamide.
| Compound Name | 2-amino-N'-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]butylamino]propyl]-3-hydroxypropanimidamide |
|---|---|
| PubChem CID | 145398326 |
| Molecular Formula | C33H44ClFN8O2 |
| Molecular Weight | 639.22 g/mol |
| Exact Mass | 638.33 |
| IUPAC Name | 2-amino-N'-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]butylamino]propyl]-3-hydroxypropanimidamide |
| SMILES | CCCC(NCCC/N=C(\N)C(N)CO)c1ccc(-n2cc3cc(-c4cc(CCCC(C)N)cc(Cl)c4F)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C33H44ClFN8O2/c1-3-6-28(39-13-5-14-40-31(38)27(37)19-44)22-9-11-24(12-10-22)43-18-23-17-29(41-32(23)42-33(43)45)25-15-21(8-4-7-20(2)36)16-26(34)30(25)35/h9-12,15-18,20,27-28,39,44H,3-8,13-14,19,36-37H2,1-2H3,(H2,38,40)(H,41,42,45) |
| InChIKey | WTBYJDXVGIMYFG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 173.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.22 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|