C31H41ClFN9O2 — CID 145398413
2-[3-[1-[5-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-3-(hydroxymethyl)-2-pyridinyl]butylamino]propyl]guanidine (PubChem CID 145398413) has the molecular formula C31H41ClFN9O2 and a molecular weight of 626.18 g/mol. Its IUPAC name is 2-[3-[1-[5-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-3-(hydroxymethyl)-2-pyridinyl]butylamino]propyl]guanidine.
| Compound Name | 2-[3-[1-[5-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-3-(hydroxymethyl)-2-pyridinyl]butylamino]propyl]guanidine |
|---|---|
| PubChem CID | 145398413 |
| Molecular Formula | C31H41ClFN9O2 |
| Molecular Weight | 626.18 g/mol |
| Exact Mass | 625.31 |
| IUPAC Name | 2-[3-[1-[5-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-3-(hydroxymethyl)-2-pyridinyl]butylamino]propyl]guanidine |
| SMILES | CCCC(NCCCN=C(N)N)c1ncc(-n2cc3cc(-c4cc(CCCC(C)N)cc(Cl)c4F)[nH]c3nc2=O)cc1CO |
| InChI | InChI=1S/C31H41ClFN9O2/c1-3-6-25(37-9-5-10-38-30(35)36)28-21(17-43)13-22(15-39-28)42-16-20-14-26(40-29(20)41-31(42)44)23-11-19(8-4-7-18(2)34)12-24(32)27(23)33/h11-16,18,25,37,43H,3-10,17,34H2,1-2H3,(H4,35,36,38)(H,40,41,44) |
| InChIKey | MTWFCXXASGPGLP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 186.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|