C34H44ClF2N7O — CID 145398129
N'-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]butyl-(2-fluoroethyl)amino]propyl]ethanimidamide (PubChem CID 145398129) has the molecular formula C34H44ClF2N7O and a molecular weight of 640.22 g/mol. Its IUPAC name is N'-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]butyl-(2-fluoroethyl)amino]propyl]ethanimidamide.
| Compound Name | N'-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]butyl-(2-fluoroethyl)amino]propyl]ethanimidamide |
|---|---|
| PubChem CID | 145398129 |
| Molecular Formula | C34H44ClF2N7O |
| Molecular Weight | 640.22 g/mol |
| Exact Mass | 639.33 |
| IUPAC Name | N'-[3-[1-[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]butyl-(2-fluoroethyl)amino]propyl]ethanimidamide |
| SMILES | CCCC(c1ccc(-n2cc3cc(-c4cc(CCCC(C)N)cc(Cl)c4F)[nH]c3nc2=O)cc1)N(CCF)CCC/N=C(\C)N |
| InChI | InChI=1S/C34H44ClF2N7O/c1-4-7-31(43(17-14-36)16-6-15-40-23(3)39)25-10-12-27(13-11-25)44-21-26-20-30(41-33(26)42-34(44)45)28-18-24(9-5-8-22(2)38)19-29(35)32(28)37/h10-13,18-22,31H,4-9,14-17,38H2,1-3H3,(H2,39,40)(H,41,42,45) |
| InChIKey | RUPBQBNAUCNMTA-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 118.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.22 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|