C34H42ClF2N7O2 — CID 145398119
N'-[3-[1-[4-[6-[5-(4-aminohex-5-enyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-fluoro-6-methoxyphenyl]butylamino]propyl]ethanimidamide (PubChem CID 145398119) has the molecular formula C34H42ClF2N7O2 and a molecular weight of 654.21 g/mol. Its IUPAC name is N'-[3-[1-[4-[6-[5-(4-aminohex-5-enyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-fluoro-6-methoxyphenyl]butylamino]propyl]ethanimidamide.
| Compound Name | N'-[3-[1-[4-[6-[5-(4-aminohex-5-enyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-fluoro-6-methoxyphenyl]butylamino]propyl]ethanimidamide |
|---|---|
| PubChem CID | 145398119 |
| Molecular Formula | C34H42ClF2N7O2 |
| Molecular Weight | 654.21 g/mol |
| Exact Mass | 653.31 |
| IUPAC Name | N'-[3-[1-[4-[6-[5-(4-aminohex-5-enyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]-2-fluoro-6-methoxyphenyl]butylamino]propyl]ethanimidamide |
| SMILES | C=CC(N)CCCc1cc(Cl)c(F)c(-c2cc3cn(-c4cc(F)c(C(CCC)NCCC/N=C(\C)N)c(OC)c4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C34H42ClF2N7O2/c1-5-9-28(41-13-8-12-40-20(3)38)31-27(36)17-24(18-30(31)46-4)44-19-22-16-29(42-33(22)43-34(44)45)25-14-21(15-26(35)32(25)37)10-7-11-23(39)6-2/h6,14-19,23,28,41H,2,5,7-13,39H2,1,3-4H3,(H2,38,40)(H,42,43,45) |
| InChIKey | DPMATIONRCEQEY-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.21 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|