C28H37N9O2 — CID 134447055
2-[3-[[4-[6-[3-[3-(2-aminoethylamino)propoxy]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 134447055) has the molecular formula C28H37N9O2 and a molecular weight of 531.67 g/mol. Its IUPAC name is 2-[3-[[4-[6-[3-[3-(2-aminoethylamino)propoxy]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-[3-[3-(2-aminoethylamino)propoxy]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 134447055 |
| Molecular Formula | C28H37N9O2 |
| Molecular Weight | 531.67 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | 2-[3-[[4-[6-[3-[3-(2-aminoethylamino)propoxy]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | NCCNCCCOc1cccc(-c2cc3cn(-c4ccc(CNCCCN=C(N)N)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C28H37N9O2/c29-10-14-32-12-3-15-39-24-5-1-4-21(16-24)25-17-22-19-37(28(38)36-26(22)35-25)23-8-6-20(7-9-23)18-33-11-2-13-34-27(30)31/h1,4-9,16-17,19,32-33H,2-3,10-15,18,29H2,(H4,30,31,34)(H,35,36,38) |
| InChIKey | NRLOAZMVYUXQOR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 174.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.67 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|