C28H35N7O4 — CID 66581726
2-[3-[[4-[6-[3-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 66581726) has the molecular formula C28H35N7O4 and a molecular weight of 533.63 g/mol. Its IUPAC name is 2-[3-[[4-[6-[3-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-[3-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 66581726 |
| Molecular Formula | C28H35N7O4 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 2-[3-[[4-[6-[3-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | COCCOCCOc1cccc(-c2cc3cn(-c4ccc(CNCCCN=C(N)N)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C28H35N7O4/c1-37-12-13-38-14-15-39-24-5-2-4-21(16-24)25-17-22-19-35(28(36)34-26(22)33-25)23-8-6-20(7-9-23)18-31-10-3-11-32-27(29)30/h2,4-9,16-17,19,31H,3,10-15,18H2,1H3,(H4,29,30,32)(H,33,34,36) |
| InChIKey | YPSOYSKGRNQSOS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 154.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|