C25H29N7O — CID 134447042
2-[3-[[4-[6-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 134447042) has the molecular formula C25H29N7O and a molecular weight of 443.56 g/mol. Its IUPAC name is 2-[3-[[4-[6-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 134447042 |
| Molecular Formula | C25H29N7O |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 2-[3-[[4-[6-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | C=C/C=C\C(=C/C=C)c1cc2cn(-c3ccc(CNCCCN=C(N)N)cc3)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C25H29N7O/c1-3-5-8-19(7-4-2)22-15-20-17-32(25(33)31-23(20)30-22)21-11-9-18(10-12-21)16-28-13-6-14-29-24(26)27/h3-5,7-12,15,17,28H,1-2,6,13-14,16H2,(H4,26,27,29)(H,30,31,33)/b8-5-,19-7+ |
| InChIKey | SMWKIHGYQAJGMM-NBFCNNMWSA-N |
| XLogP | 2.78 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|