C24H35N9O3S — CID 66582032
2-[3-[[4-[2-oxo-6-[2-(piperidin-4-ylsulfamoyl)ethyl]-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 66582032) has the molecular formula C24H35N9O3S and a molecular weight of 529.67 g/mol. Its IUPAC name is 2-[3-[[4-[2-oxo-6-[2-(piperidin-4-ylsulfamoyl)ethyl]-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[2-oxo-6-[2-(piperidin-4-ylsulfamoyl)ethyl]-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 66582032 |
| Molecular Formula | C24H35N9O3S |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | 2-[3-[[4-[2-oxo-6-[2-(piperidin-4-ylsulfamoyl)ethyl]-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | NC(N)=NCCCNCc1ccc(-n2cc3cc(CCS(=O)(=O)NC4CCNCC4)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C24H35N9O3S/c25-23(26)29-10-1-9-28-15-17-2-4-21(5-3-17)33-16-18-14-20(30-22(18)31-24(33)34)8-13-37(35,36)32-19-6-11-27-12-7-19/h2-5,14,16,19,27-28,32H,1,6-13,15H2,(H4,25,26,29)(H,30,31,34) |
| InChIKey | OOKSNYRFGICUIV-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 185.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|